C22H19N3O2 — CID 30375491
1-benzhydryl-3-(2-oxo-1,3-dihydroindol-5-yl)urea (PubChem CID 30375491) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-benzhydryl-3-(2-oxo-1,3-dihydroindol-5-yl)urea.
| Compound Name | 1-benzhydryl-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 30375491 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-benzhydryl-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
| SMILES | O=C1Cc2cc(NC(=O)NC(c3ccccc3)c3ccccc3)ccc2N1 |
| InChI | InChI=1S/C22H19N3O2/c26-20-14-17-13-18(11-12-19(17)24-20)23-22(27)25-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,21H,14H2,(H,24,26)(H2,23,25,27) |
| InChIKey | JLKKNDHNAPCFLQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |