C17H17N3O4 — CID 30375542
1-(3,5-dimethoxyphenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea (PubChem CID 30375542) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 30375542 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc3c(c2)CC(=O)N3)cc(OC)c1 |
| InChI | InChI=1S/C17H17N3O4/c1-23-13-7-12(8-14(9-13)24-2)19-17(22)18-11-3-4-15-10(5-11)6-16(21)20-15/h3-5,7-9H,6H2,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | JUYSMFTWVLKBLI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |