C17H17N3O4 — CID 155113917
1-(2,5-dimethoxyphenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea (PubChem CID 155113917) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 155113917 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C17H17N3O4/c1-23-12-4-6-15(24-2)14(9-12)20-17(22)18-11-3-5-13-10(7-11)8-16(21)19-13/h3-7,9H,8H2,1-2H3,(H,19,21)(H2,18,20,22) |
| InChIKey | ZMHIUAOEBGPASZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |