C16H12N4O2 — CID 155113952
1-(4-cyanophenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea (PubChem CID 155113952) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea.
| Compound Name | 1-(4-cyanophenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 155113952 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(4-cyanophenyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2ccc3c(c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C16H12N4O2/c17-9-10-1-3-12(4-2-10)18-16(22)19-13-5-6-14-11(7-13)8-15(21)20-14/h1-7H,8H2,(H,20,21)(H2,18,19,22) |
| InChIKey | IQIWUOTUOMCHCL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |