C10H9N3O — CID 115130733
2-[(2-oxo-1,3-dihydroindol-5-yl)amino]acetonitrile (PubChem CID 115130733) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-dihydroindol-5-yl)amino]acetonitrile.
| Compound Name | 2-[(2-oxo-1,3-dihydroindol-5-yl)amino]acetonitrile |
|---|---|
| PubChem CID | 115130733 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 2-[(2-oxo-1,3-dihydroindol-5-yl)amino]acetonitrile |
| SMILES | N#CCNc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C10H9N3O/c11-3-4-12-8-1-2-9-7(5-8)6-10(14)13-9/h1-2,5,12H,4,6H2,(H,13,14) |
| InChIKey | YDYQRPXCINJZCL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|