C11H16N4O — CID 115119380
5-(2,3-diaminopropylamino)-1,3-dihydroindol-2-one (PubChem CID 115119380) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 5-(2,3-diaminopropylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2,3-diaminopropylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115119380 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 5-(2,3-diaminopropylamino)-1,3-dihydroindol-2-one |
| SMILES | NCC(N)CNc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C11H16N4O/c12-5-8(13)6-14-9-1-2-10-7(3-9)4-11(16)15-10/h1-3,8,14H,4-6,12-13H2,(H,15,16) |
| InChIKey | WISQFWOJSKCHLE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |