C12H15N3O2 — CID 22690108
4-amino-N-(2-oxo-1,3-dihydroindol-5-yl)butanamide (PubChem CID 22690108) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-amino-N-(2-oxo-1,3-dihydroindol-5-yl)butanamide.
| Compound Name | 4-amino-N-(2-oxo-1,3-dihydroindol-5-yl)butanamide |
|---|---|
| PubChem CID | 22690108 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-amino-N-(2-oxo-1,3-dihydroindol-5-yl)butanamide |
| SMILES | NCCCC(=O)Nc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C12H15N3O2/c13-5-1-2-11(16)14-9-3-4-10-8(6-9)7-12(17)15-10/h3-4,6H,1-2,5,7,13H2,(H,14,16)(H,15,17) |
| InChIKey | WNHXZYNYPZTARX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |