C17H25N3O2 — CID 119775274
7-amino-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)heptanamide (PubChem CID 119775274) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 7-amino-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)heptanamide.
| Compound Name | 7-amino-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)heptanamide |
|---|---|
| PubChem CID | 119775274 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 7-amino-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)heptanamide |
| SMILES | NCCCCCCC(=O)Nc1ccc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C17H25N3O2/c18-11-4-2-1-3-7-16(21)19-14-9-10-15-13(12-14)6-5-8-17(22)20-15/h9-10,12H,1-8,11,18H2,(H,19,21)(H,20,22) |
| InChIKey | DLMYUMWIQWRGRC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|