C16H24N2O — CID 24700487
7-amino-N-(2,3-dihydro-1H-inden-5-yl)heptanamide (PubChem CID 24700487) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 7-amino-N-(2,3-dihydro-1H-inden-5-yl)heptanamide.
| Compound Name | 7-amino-N-(2,3-dihydro-1H-inden-5-yl)heptanamide |
|---|---|
| PubChem CID | 24700487 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 7-amino-N-(2,3-dihydro-1H-inden-5-yl)heptanamide |
| SMILES | NCCCCCCC(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H24N2O/c17-11-4-2-1-3-8-16(19)18-15-10-9-13-6-5-7-14(13)12-15/h9-10,12H,1-8,11,17H2,(H,18,19) |
| InChIKey | SMJHJXNFLSGOAS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|