C15H23ClN2O2 — CID 119728510
7-amino-N-(2,3-dihydro-1-benzofuran-5-yl)heptanamide;hydrochloride (PubChem CID 119728510) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 7-amino-N-(2,3-dihydro-1-benzofuran-5-yl)heptanamide;hydrochloride.
| Compound Name | 7-amino-N-(2,3-dihydro-1-benzofuran-5-yl)heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119728510 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 7-amino-N-(2,3-dihydro-1-benzofuran-5-yl)heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)Nc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H22N2O2.ClH/c16-9-4-2-1-3-5-15(18)17-13-6-7-14-12(11-13)8-10-19-14;/h6-7,11H,1-5,8-10,16H2,(H,17,18);1H |
| InChIKey | QWALCOMSUHKLRW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|