C13H16BrNO2 — CID 107909036
5-bromo-N-(2,3-dihydro-1-benzofuran-5-yl)pentanamide (PubChem CID 107909036) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is 5-bromo-N-(2,3-dihydro-1-benzofuran-5-yl)pentanamide.
| Compound Name | 5-bromo-N-(2,3-dihydro-1-benzofuran-5-yl)pentanamide |
|---|---|
| PubChem CID | 107909036 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-bromo-N-(2,3-dihydro-1-benzofuran-5-yl)pentanamide |
| SMILES | O=C(CCCCBr)Nc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C13H16BrNO2/c14-7-2-1-3-13(16)15-11-4-5-12-10(9-11)6-8-17-12/h4-5,9H,1-3,6-8H2,(H,15,16) |
| InChIKey | JDCZXDKBYJNSPI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|