C14H19N3O2 — CID 119318721
4-amino-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)butanamide (PubChem CID 119318721) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-amino-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)butanamide.
| Compound Name | 4-amino-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)butanamide |
|---|---|
| PubChem CID | 119318721 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-amino-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)butanamide |
| SMILES | NCCCC(=O)Nc1ccc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C14H19N3O2/c15-8-2-5-13(18)16-11-6-7-12-10(9-11)3-1-4-14(19)17-12/h6-7,9H,1-5,8,15H2,(H,16,18)(H,17,19) |
| InChIKey | NNGZBOQUOUYTJT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |