C15H19N3O4 — CID 122079384
4-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)carbamoylamino]butanoic acid (PubChem CID 122079384) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122079384 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1ccc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C15H19N3O4/c19-13-4-1-3-10-9-11(6-7-12(10)18-13)17-15(22)16-8-2-5-14(20)21/h6-7,9H,1-5,8H2,(H,18,19)(H,20,21)(H2,16,17,22) |
| InChIKey | AHXVJXUXQIYWHF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|