C11H13NOS — CID 60650065
N-(2,3-dihydro-1H-inden-5-yl)-2-sulfanylacetamide (PubChem CID 60650065) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2-sulfanylacetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 60650065 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2-sulfanylacetamide |
| SMILES | O=C(CS)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C11H13NOS/c13-11(7-14)12-10-5-4-8-2-1-3-9(8)6-10/h4-6,14H,1-3,7H2,(H,12,13) |
| InChIKey | PJPFWGAYYAQGLX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|