C11H13NO2S — CID 115166948
N-(3,4-dihydro-2H-chromen-6-yl)-2-sulfanylacetamide (PubChem CID 115166948) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-6-yl)-2-sulfanylacetamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-6-yl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115166948 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-6-yl)-2-sulfanylacetamide |
| SMILES | O=C(CS)Nc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C11H13NO2S/c13-11(7-15)12-9-3-4-10-8(6-9)2-1-5-14-10/h3-4,6,15H,1-2,5,7H2,(H,12,13) |
| InChIKey | ZLVHJWMGWCWPKN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|