C12H15NOS — CID 115166897
2-sulfanyl-N-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 115166897) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-sulfanyl-N-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | 2-sulfanyl-N-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 115166897 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-sulfanyl-N-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | O=C(CS)Nc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C12H15NOS/c14-12(8-15)13-11-6-5-9-3-1-2-4-10(9)7-11/h5-7,15H,1-4,8H2,(H,13,14) |
| InChIKey | QJUJISXTHNLKIH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|