C11H15N3O — CID 115192342
1-amino-3-(5,6,7,8-tetrahydronaphthalen-2-yl)urea (PubChem CID 115192342) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-amino-3-(5,6,7,8-tetrahydronaphthalen-2-yl)urea.
| Compound Name | 1-amino-3-(5,6,7,8-tetrahydronaphthalen-2-yl)urea |
|---|---|
| PubChem CID | 115192342 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-amino-3-(5,6,7,8-tetrahydronaphthalen-2-yl)urea |
| SMILES | NNC(=O)Nc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C11H15N3O/c12-14-11(15)13-10-6-5-8-3-1-2-4-9(8)7-10/h5-7H,1-4,12H2,(H2,13,14,15) |
| InChIKey | LMLIQVCQYQYTBX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|