C11H11NO2 — CID 115165888
N-(2,3-dihydro-1H-inden-5-yl)-2-oxoacetamide (PubChem CID 115165888) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2-oxoacetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 115165888 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2-oxoacetamide |
| SMILES | O=CC(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C11H11NO2/c13-7-11(14)12-10-5-4-8-2-1-3-9(8)6-10/h4-7H,1-3H2,(H,12,14) |
| InChIKey | VUQHKFSUOBQIJU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|