C15H17NO3 — CID 62095213
1-(2,3-dihydro-1H-inden-5-ylcarbamoyl)cyclobutane-1-carboxylic acid (PubChem CID 62095213) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylcarbamoyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylcarbamoyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 62095213 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylcarbamoyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)Nc2ccc3c(c2)CCC3)CCC1 |
| InChI | InChI=1S/C15H17NO3/c17-13(15(14(18)19)7-2-8-15)16-12-6-5-10-3-1-4-11(10)9-12/h5-6,9H,1-4,7-8H2,(H,16,17)(H,18,19) |
| InChIKey | NJNMOBWFOJLEKO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|