C20H25NO2 — CID 8920748
(5S,7R)-N-(2,3-dihydro-1H-inden-5-yl)-3-hydroxyadamantane-1-carboxamide (PubChem CID 8920748) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (5S,7R)-N-(2,3-dihydro-1H-inden-5-yl)-3-hydroxyadamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-(2,3-dihydro-1H-inden-5-yl)-3-hydroxyadamantane-1-carboxamide |
|---|---|
| PubChem CID | 8920748 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (5S,7R)-N-(2,3-dihydro-1H-inden-5-yl)-3-hydroxyadamantane-1-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)C12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C20H25NO2/c22-18(21-17-5-4-15-2-1-3-16(15)7-17)19-8-13-6-14(9-19)11-20(23,10-13)12-19/h4-5,7,13-14,23H,1-3,6,8-12H2,(H,21,22)/t13-,14+,19?,20? |
| InChIKey | DOAAVIKITWJTBZ-LWYUSKRHSA-N |
| XLogP | 3.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |