C21H28N2O3 — CID 4835232
3-hydroxy-N-(4-morpholin-4-ylphenyl)adamantane-1-carboxamide (PubChem CID 4835232) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-hydroxy-N-(4-morpholin-4-ylphenyl)adamantane-1-carboxamide.
| Compound Name | 3-hydroxy-N-(4-morpholin-4-ylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4835232 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3-hydroxy-N-(4-morpholin-4-ylphenyl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C21H28N2O3/c24-19(20-10-15-9-16(11-20)13-21(25,12-15)14-20)22-17-1-3-18(4-2-17)23-5-7-26-8-6-23/h1-4,15-16,25H,5-14H2,(H,22,24) |
| InChIKey | LTFSUEXZZGAQMY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|