C17H19BrClNO — CID 8762451
(5S,7R)-3-bromo-N-(4-chlorophenyl)adamantane-1-carboxamide (PubChem CID 8762451) has the molecular formula C17H19BrClNO and a molecular weight of 368.70 g/mol. Its IUPAC name is (5S,7R)-3-bromo-N-(4-chlorophenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-bromo-N-(4-chlorophenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 8762451 |
| Molecular Formula | C17H19BrClNO |
| Molecular Weight | 368.70 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | (5S,7R)-3-bromo-N-(4-chlorophenyl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C17H19BrClNO/c18-17-8-11-5-12(9-17)7-16(6-11,10-17)15(21)20-14-3-1-13(19)2-4-14/h1-4,11-12H,5-10H2,(H,20,21)/t11-,12+,16?,17? |
| InChIKey | RVFBLZUPVSVJSJ-GKUGFIGPSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|