C21H24BrN3O — CID 7330846
(5S,7R)-3-bromo-N-(2,3-dimethylquinoxalin-6-yl)adamantane-1-carboxamide (PubChem CID 7330846) has the molecular formula C21H24BrN3O and a molecular weight of 414.35 g/mol. Its IUPAC name is (5S,7R)-3-bromo-N-(2,3-dimethylquinoxalin-6-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-bromo-N-(2,3-dimethylquinoxalin-6-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7330846 |
| Molecular Formula | C21H24BrN3O |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (5S,7R)-3-bromo-N-(2,3-dimethylquinoxalin-6-yl)adamantane-1-carboxamide |
| SMILES | Cc1nc2ccc(NC(=O)C34C[C@@H]5C[C@@H](CC(Br)(C5)C3)C4)cc2nc1C |
| InChI | InChI=1S/C21H24BrN3O/c1-12-13(2)24-18-6-16(3-4-17(18)23-12)25-19(26)20-7-14-5-15(8-20)10-21(22,9-14)11-20/h3-4,6,14-15H,5,7-11H2,1-2H3,(H,25,26)/t14-,15+,20?,21? |
| InChIKey | QGZXENKHPQTHGI-XFKLWTPLSA-N |
| XLogP | 4.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|