C20H24BrN3O3 — CID 55679115
N-[3-[(2-amino-2-oxoethyl)carbamoyl]phenyl]-3-bromoadamantane-1-carboxamide (PubChem CID 55679115) has the molecular formula C20H24BrN3O3 and a molecular weight of 434.33 g/mol. Its IUPAC name is N-[3-[(2-amino-2-oxoethyl)carbamoyl]phenyl]-3-bromoadamantane-1-carboxamide.
| Compound Name | N-[3-[(2-amino-2-oxoethyl)carbamoyl]phenyl]-3-bromoadamantane-1-carboxamide |
|---|---|
| PubChem CID | 55679115 |
| Molecular Formula | C20H24BrN3O3 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[3-[(2-amino-2-oxoethyl)carbamoyl]phenyl]-3-bromoadamantane-1-carboxamide |
| SMILES | NC(=O)CNC(=O)c1cccc(NC(=O)C23CC4CC(CC(Br)(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H24BrN3O3/c21-20-8-12-4-13(9-20)7-19(6-12,11-20)18(27)24-15-3-1-2-14(5-15)17(26)23-10-16(22)25/h1-3,5,12-13H,4,6-11H2,(H2,22,25)(H,23,26)(H,24,27) |
| InChIKey | GFZASPNRQVRZDE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|