C17H19BrN2O3 — CID 98116279
(5R,7R)-3-bromo-N-(3-nitrophenyl)adamantane-1-carboxamide (PubChem CID 98116279) has the molecular formula C17H19BrN2O3 and a molecular weight of 379.25 g/mol. Its IUPAC name is (5R,7R)-3-bromo-N-(3-nitrophenyl)adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-bromo-N-(3-nitrophenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98116279 |
| Molecular Formula | C17H19BrN2O3 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | (5R,7R)-3-bromo-N-(3-nitrophenyl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)C12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C17H19BrN2O3/c18-17-8-11-4-12(9-17)7-16(6-11,10-17)15(21)19-13-2-1-3-14(5-13)20(22)23/h1-3,5,11-12H,4,6-10H2,(H,19,21)/t11-,12-,16?,17?/m1/s1 |
| InChIKey | LZEJXYVDFWZHME-VDQHWBOFSA-N |
| XLogP | 4.27 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|