C19H23BrN2O2 — CID 16550312
3-bromo-N-[3-(methylcarbamoyl)phenyl]adamantane-1-carboxamide (PubChem CID 16550312) has the molecular formula C19H23BrN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 3-bromo-N-[3-(methylcarbamoyl)phenyl]adamantane-1-carboxamide.
| Compound Name | 3-bromo-N-[3-(methylcarbamoyl)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 16550312 |
| Molecular Formula | C19H23BrN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 3-bromo-N-[3-(methylcarbamoyl)phenyl]adamantane-1-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C23CC4CC(CC(Br)(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H23BrN2O2/c1-21-16(23)14-3-2-4-15(6-14)22-17(24)18-7-12-5-13(8-18)10-19(20,9-12)11-18/h2-4,6,12-13H,5,7-11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | ABMQUYOMJPXRDX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|