C18H21BrFNO — CID 7778661
(5S,7R)-3-bromo-N-(3-fluoro-4-methylphenyl)adamantane-1-carboxamide (PubChem CID 7778661) has the molecular formula C18H21BrFNO and a molecular weight of 366.27 g/mol. Its IUPAC name is (5S,7R)-3-bromo-N-(3-fluoro-4-methylphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-bromo-N-(3-fluoro-4-methylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7778661 |
| Molecular Formula | C18H21BrFNO |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (5S,7R)-3-bromo-N-(3-fluoro-4-methylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C23C[C@@H]4C[C@@H](CC(Br)(C4)C2)C3)cc1F |
| InChI | InChI=1S/C18H21BrFNO/c1-11-2-3-14(5-15(11)20)21-16(22)17-6-12-4-13(7-17)9-18(19,8-12)10-17/h2-3,5,12-13H,4,6-10H2,1H3,(H,21,22)/t12-,13+,17?,18? |
| InChIKey | CIQKUVUEMFQAMO-NLKGSNSHSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|