C28H34N2O6 — CID 2964586
1-N,3-N-bis(3,4-dimethoxyphenyl)adamantane-1,3-dicarboxamide (PubChem CID 2964586) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is 1-N,3-N-bis(3,4-dimethoxyphenyl)adamantane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3,4-dimethoxyphenyl)adamantane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 2964586 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 1-N,3-N-bis(3,4-dimethoxyphenyl)adamantane-1,3-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C23CC4CC(C2)CC(C(=O)Nc2ccc(OC)c(OC)c2)(C4)C3)cc1OC |
| InChI | InChI=1S/C28H34N2O6/c1-33-21-7-5-19(10-23(21)35-3)29-25(31)27-12-17-9-18(13-27)15-28(14-17,16-27)26(32)30-20-6-8-22(34-2)24(11-20)36-4/h5-8,10-11,17-18H,9,12-16H2,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | WHAMBKMOKFPCIX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |