C19H24BrNO3 — CID 7698259
(5S,7R)-3-bromo-N-(2,4-dimethoxyphenyl)adamantane-1-carboxamide (PubChem CID 7698259) has the molecular formula C19H24BrNO3 and a molecular weight of 394.31 g/mol. Its IUPAC name is (5S,7R)-3-bromo-N-(2,4-dimethoxyphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-bromo-N-(2,4-dimethoxyphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7698259 |
| Molecular Formula | C19H24BrNO3 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (5S,7R)-3-bromo-N-(2,4-dimethoxyphenyl)adamantane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C23C[C@@H]4C[C@@H](CC(Br)(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C19H24BrNO3/c1-23-14-3-4-15(16(6-14)24-2)21-17(22)18-7-12-5-13(8-18)10-19(20,9-12)11-18/h3-4,6,12-13H,5,7-11H2,1-2H3,(H,21,22)/t12-,13+,18?,19? |
| InChIKey | PLPXGULYVHUZNY-NFAYLAGKSA-N |
| XLogP | 4.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|