C20H25BrN2O3 — CID 98464635
(5R,7R)-N-[4-(2-amino-2-oxoethoxy)-2-methylphenyl]-3-bromoadamantane-1-carboxamide (PubChem CID 98464635) has the molecular formula C20H25BrN2O3 and a molecular weight of 421.34 g/mol. Its IUPAC name is (5R,7R)-N-[4-(2-amino-2-oxoethoxy)-2-methylphenyl]-3-bromoadamantane-1-carboxamide.
| Compound Name | (5R,7R)-N-[4-(2-amino-2-oxoethoxy)-2-methylphenyl]-3-bromoadamantane-1-carboxamide |
|---|---|
| PubChem CID | 98464635 |
| Molecular Formula | C20H25BrN2O3 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (5R,7R)-N-[4-(2-amino-2-oxoethoxy)-2-methylphenyl]-3-bromoadamantane-1-carboxamide |
| SMILES | Cc1cc(OCC(N)=O)ccc1NC(=O)C12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C20H25BrN2O3/c1-12-4-15(26-10-17(22)24)2-3-16(12)23-18(25)19-6-13-5-14(7-19)9-20(21,8-13)11-19/h2-4,13-14H,5-11H2,1H3,(H2,22,24)(H,23,25)/t13-,14-,19?,20?/m1/s1 |
| InChIKey | OLJCUARHWITMMZ-RCRDTURJSA-N |
| XLogP | 3.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|