C21H25BrO3 — CID 4218406
[2-(3,4-dimethylphenyl)-2-oxoethyl] 3-bromoadamantane-1-carboxylate (PubChem CID 4218406) has the molecular formula C21H25BrO3 and a molecular weight of 405.33 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] 3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 4218406 |
| Molecular Formula | C21H25BrO3 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 3-bromoadamantane-1-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)C23CC4CC(CC(Br)(C4)C2)C3)cc1C |
| InChI | InChI=1S/C21H25BrO3/c1-13-3-4-17(5-14(13)2)18(23)11-25-19(24)20-7-15-6-16(8-20)10-21(22,9-15)12-20/h3-5,15-16H,6-12H2,1-2H3 |
| InChIKey | BLNDSOBGMGPPSP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|