C21H23BrO5 — CID 2413062
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 2413062) has the molecular formula C21H23BrO5 and a molecular weight of 435.31 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 2413062 |
| Molecular Formula | C21H23BrO5 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H23BrO5/c22-21-9-13-5-14(10-21)8-20(7-13,12-21)19(24)27-11-16(23)15-1-2-17-18(6-15)26-4-3-25-17/h1-2,6,13-14H,3-5,7-12H2/t13-,14+,20?,21? |
| InChIKey | QTWRJGWXERWCSP-ZXPDZVFASA-N |
| XLogP | 3.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|