C25H31ClO3 — CID 7843965
[2-(4-cyclohexylphenyl)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 7843965) has the molecular formula C25H31ClO3 and a molecular weight of 414.97 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7843965 |
| Molecular Formula | C25H31ClO3 |
| Molecular Weight | 414.97 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H31ClO3/c26-25-13-17-10-18(14-25)12-24(11-17,16-25)23(28)29-15-22(27)21-8-6-20(7-9-21)19-4-2-1-3-5-19/h6-9,17-19H,1-5,10-16H2/t17-,18+,24?,25? |
| InChIKey | QWWXZJGRATXOHP-FLCJAFJVSA-N |
| XLogP | 6.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.97 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|