C20H22Cl2N2O4 — CID 5124422
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 3-chloroadamantane-1-carboxylate (PubChem CID 5124422) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 3-chloroadamantane-1-carboxylate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 5124422 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 3-chloroadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(Cl)(C3)C1)C2)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O4/c21-15-3-1-14(2-4-15)17(26)24-23-16(25)10-28-18(27)19-6-12-5-13(7-19)9-20(22,8-12)11-19/h1-4,12-13H,5-11H2,(H,23,25)(H,24,26) |
| InChIKey | CMBALWIJYVTBDK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|