C18H19Cl3N2O3 — CID 98301041
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (5R,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 98301041) has the molecular formula C18H19Cl3N2O3 and a molecular weight of 417.72 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (5R,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (5R,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98301041 |
| Molecular Formula | C18H19Cl3N2O3 |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (5R,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl3N2O3/c19-12-2-13(20)15(22-7-12)23-14(24)8-26-16(25)17-3-10-1-11(4-17)6-18(21,5-10)9-17/h2,7,10-11H,1,3-6,8-9H2,(H,22,23,24)/t10-,11-,17?,18?/m1/s1 |
| InChIKey | MUZBGGDCLYKSKS-BASMTZLZSA-N |
| XLogP | 4.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|