C21H26ClNO5 — CID 98592727
[2-(3,4-dimethoxyanilino)-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate (PubChem CID 98592727) has the molecular formula C21H26ClNO5 and a molecular weight of 407.89 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98592727 |
| Molecular Formula | C21H26ClNO5 |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)C23C[C@@H]4C[C@H](CC(Cl)(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C21H26ClNO5/c1-26-16-4-3-15(6-17(16)27-2)23-18(24)11-28-19(25)20-7-13-5-14(8-20)10-21(22,9-13)12-20/h3-4,6,13-14H,5,7-12H2,1-2H3,(H,23,24)/t13-,14-,20?,21?/m0/s1 |
| InChIKey | PJBVZDNWBCULNO-SUXCYGLUSA-N |
| XLogP | 3.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|