C21H27ClN2O5S — CID 4694012
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-chloroadamantane-1-carboxylate (PubChem CID 4694012) has the molecular formula C21H27ClN2O5S and a molecular weight of 454.98 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-chloroadamantane-1-carboxylate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 4694012 |
| Molecular Formula | C21H27ClN2O5S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-chloroadamantane-1-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COC(=O)C23CC4CC(CC(Cl)(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H27ClN2O5S/c1-24(2)30(27,28)17-5-3-4-16(7-17)23-18(25)12-29-19(26)20-8-14-6-15(9-20)11-21(22,10-14)13-20/h3-5,7,14-15H,6,8-13H2,1-2H3,(H,23,25) |
| InChIKey | ICUPEMMVSYUIPM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|