C26H30N2O5S — CID 4526537
[2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 4526537) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is [2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 4526537 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=O)COC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C26H30N2O5S/c1-28(22-7-3-2-4-8-22)34(31,32)23-9-5-6-21(13-23)27-24(29)17-33-25(30)26-14-18-10-19(15-26)12-20(11-18)16-26/h2-9,13,18-20H,10-12,14-17H2,1H3,(H,27,29) |
| InChIKey | IFQMNNDJIGEFFD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |