C20H25NO3S — CID 5056388
[2-(3-methylsulfanylanilino)-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 5056388) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 5056388 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | CSc1cccc(NC(=O)COC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H25NO3S/c1-25-17-4-2-3-16(8-17)21-18(22)12-24-19(23)20-9-13-5-14(10-20)7-15(6-13)11-20/h2-4,8,13-15H,5-7,9-12H2,1H3,(H,21,22) |
| InChIKey | UVHHQIZOAODUNO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |