C20H25NO5 — CID 7470795
[2-(3-methoxyanilino)-2-oxoethyl] (5S,7R)-3-hydroxyadamantane-1-carboxylate (PubChem CID 7470795) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] (5S,7R)-3-hydroxyadamantane-1-carboxylate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] (5S,7R)-3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7470795 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] (5S,7R)-3-hydroxyadamantane-1-carboxylate |
| SMILES | COc1cccc(NC(=O)COC(=O)C23C[C@@H]4C[C@@H](CC(O)(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H25NO5/c1-25-16-4-2-3-15(6-16)21-17(22)11-26-18(23)19-7-13-5-14(8-19)10-20(24,9-13)12-19/h2-4,6,13-14,24H,5,7-12H2,1H3,(H,21,22)/t13-,14+,19?,20? |
| InChIKey | ISQNGMNZSSAEFX-LWYUSKRHSA-N |
| XLogP | 2.51 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |