C19H22ClNO4 — CID 98306321
[2-(3-chloroanilino)-2-oxoethyl] (5R,7R)-3-hydroxyadamantane-1-carboxylate (PubChem CID 98306321) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] (5R,7R)-3-hydroxyadamantane-1-carboxylate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] (5R,7R)-3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98306321 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] (5R,7R)-3-hydroxyadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@H]3C[C@@H](CC(O)(C3)C1)C2)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClNO4/c20-14-2-1-3-15(5-14)21-16(22)10-25-17(23)18-6-12-4-13(7-18)9-19(24,8-12)11-18/h1-3,5,12-13,24H,4,6-11H2,(H,21,22)/t12-,13-,18?,19?/m1/s1 |
| InChIKey | LCIUJAKSPKTQQY-NYYJTOMGSA-N |
| XLogP | 3.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |