C21H27NO6 — CID 4572658
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate (PubChem CID 4572658) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 4572658 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate |
| SMILES | COc1cc(NC(=O)COC(=O)C23CC4CC(CC(O)(C4)C2)C3)cc(OC)c1 |
| InChI | InChI=1S/C21H27NO6/c1-26-16-4-15(5-17(6-16)27-2)22-18(23)11-28-19(24)20-7-13-3-14(8-20)10-21(25,9-13)12-20/h4-6,13-14,25H,3,7-12H2,1-2H3,(H,22,23) |
| InChIKey | PJUAFSPATVBBMY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |