C20H24BrNO4 — CID 7415160
[2-(4-methoxyanilino)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 7415160) has the molecular formula C20H24BrNO4 and a molecular weight of 422.32 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7415160 |
| Molecular Formula | C20H24BrNO4 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)C23C[C@@H]4C[C@@H](CC(Br)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H24BrNO4/c1-25-16-4-2-15(3-5-16)22-17(23)11-26-18(24)19-7-13-6-14(8-19)10-20(21,9-13)12-19/h2-5,13-14H,6-12H2,1H3,(H,22,23)/t13-,14+,19?,20? |
| InChIKey | STCRUUKANRMTDH-LWYUSKRHSA-N |
| XLogP | 3.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|