C21H26N2O4 — CID 4877219
[2-(4-acetamidoanilino)-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 4877219) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 4877219 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-13(24)22-17-2-4-18(5-3-17)23-19(25)12-27-20(26)21-9-14-6-15(10-21)8-16(7-14)11-21/h2-5,14-16H,6-12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | IKMRUVKUCJUBOQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |