C19H23NO3 — CID 51152656
(4-acetamidophenyl) adamantane-1-carboxylate (PubChem CID 51152656) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (4-acetamidophenyl) adamantane-1-carboxylate.
| Compound Name | (4-acetamidophenyl) adamantane-1-carboxylate |
|---|---|
| PubChem CID | 51152656 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (4-acetamidophenyl) adamantane-1-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-12(21)20-16-2-4-17(5-3-16)23-18(22)19-9-13-6-14(10-19)8-15(7-13)11-19/h2-5,13-15H,6-11H2,1H3,(H,20,21) |
| InChIKey | CPXFTALYZLDJRI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|