About (4-butan-2-ylphenyl) adamantane-1-carboxylate
(4-butan-2-ylphenyl) adamantane-1-carboxylate (PubChem CID 89342175) has the molecular formula C21H28O2
and a molecular weight of 312.45 g/mol. Its IUPAC name is (4-butan-2-ylphenyl) adamantane-1-carboxylate.
Molecular Properties
| Compound Name | (4-butan-2-ylphenyl) adamantane-1-carboxylate |
| PubChem CID | 89342175 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (4-butan-2-ylphenyl) adamantane-1-carboxylate |
| SMILES | CCC(C)c1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H28O2/c1-3-14(2)18-4-6-19(7-5-18)23-20(22)21-11-15-8-16(12-21)10-17(9-15)13-21/h4-7,14-17H,3,8-13H2,1-2H3 |
| InChIKey | CWFOYGZSSXZALQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-butan-2-ylphenyl) adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butan-2-ylphenyl) adamantane-1-carboxylate?
The IUPAC name of (4-butan-2-ylphenyl) adamantane-1-carboxylate (CID 89342175) is (4-butan-2-ylphenyl) adamantane-1-carboxylate.
What is the SMILES notation for (4-butan-2-ylphenyl) adamantane-1-carboxylate?
The canonical SMILES for (4-butan-2-ylphenyl) adamantane-1-carboxylate is CCC(C)c1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of (4-butan-2-ylphenyl) adamantane-1-carboxylate?
The InChIKey is CWFOYGZSSXZALQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O2/c1-3-14(2)18-4-6-19(7-5-18)23-20(22)21-11-15-8-16(12-21)10-17(9-15)13-21/h4-7,14-17H,3,8-13H2,1-2H3.
What are the key properties of (4-butan-2-ylphenyl) adamantane-1-carboxylate?
(4-butan-2-ylphenyl) adamantane-1-carboxylate has a molecular weight of 312.45 g/mol, XLogP of 5.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butan-2-ylphenyl) adamantane-1-carboxylate is sourced from PubChem (CID 89342175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).