C24H34O2 — CID 129035738
[4-(2,4-dimethylpentan-3-yl)phenyl] adamantane-1-carboxylate (PubChem CID 129035738) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is [4-(2,4-dimethylpentan-3-yl)phenyl] adamantane-1-carboxylate.
| Compound Name | [4-(2,4-dimethylpentan-3-yl)phenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 129035738 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [4-(2,4-dimethylpentan-3-yl)phenyl] adamantane-1-carboxylate |
| SMILES | CC(C)C(c1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cc1)C(C)C |
| InChI | InChI=1S/C24H34O2/c1-15(2)22(16(3)4)20-5-7-21(8-6-20)26-23(25)24-12-17-9-18(13-24)11-19(10-17)14-24/h5-8,15-19,22H,9-14H2,1-4H3 |
| InChIKey | FLXXGQPILVTUJL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|