C17H24ClNO3 — CID 2829061
(6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrate;hydrochloride (PubChem CID 2829061) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrate;hydrochloride.
| Compound Name | (6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrate;hydrochloride |
|---|---|
| PubChem CID | 2829061 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrate;hydrochloride |
| SMILES | Cc1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cn1.Cl.O |
| InChI | InChI=1S/C17H21NO2.ClH.H2O/c1-11-2-3-15(10-18-11)20-16(19)17-7-12-4-13(8-17)6-14(5-12)9-17;;/h2-3,10,12-14H,4-9H2,1H3;1H;1H2 |
| InChIKey | GTIHOZBMIIBOCY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |