C27H31NO4 — CID 2827380
[2-[(4-propan-2-yloxyphenyl)carbamoyl]phenyl] adamantane-1-carboxylate (PubChem CID 2827380) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is [2-[(4-propan-2-yloxyphenyl)carbamoyl]phenyl] adamantane-1-carboxylate.
| Compound Name | [2-[(4-propan-2-yloxyphenyl)carbamoyl]phenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 2827380 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | [2-[(4-propan-2-yloxyphenyl)carbamoyl]phenyl] adamantane-1-carboxylate |
| SMILES | CC(C)Oc1ccc(NC(=O)c2ccccc2OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C27H31NO4/c1-17(2)31-22-9-7-21(8-10-22)28-25(29)23-5-3-4-6-24(23)32-26(30)27-14-18-11-19(15-27)13-20(12-18)16-27/h3-10,17-20H,11-16H2,1-2H3,(H,28,29) |
| InChIKey | KDYRZZDLHVIQKK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|