C16H15Br2NO2 — CID 114370108
2,5-dibromo-N-(4-propan-2-yloxyphenyl)benzamide (PubChem CID 114370108) has the molecular formula C16H15Br2NO2 and a molecular weight of 413.11 g/mol. Its IUPAC name is 2,5-dibromo-N-(4-propan-2-yloxyphenyl)benzamide.
| Compound Name | 2,5-dibromo-N-(4-propan-2-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 114370108 |
| Molecular Formula | C16H15Br2NO2 |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | 2,5-dibromo-N-(4-propan-2-yloxyphenyl)benzamide |
| SMILES | CC(C)Oc1ccc(NC(=O)c2cc(Br)ccc2Br)cc1 |
| InChI | InChI=1S/C16H15Br2NO2/c1-10(2)21-13-6-4-12(5-7-13)19-16(20)14-9-11(17)3-8-15(14)18/h3-10H,1-2H3,(H,19,20) |
| InChIKey | AQRSGOFDOSLBRE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |